C23H33N3O2 — CID 70637767
4-[[4-[2-(diethylamino)ethyl]-2-phenylpiperazin-1-yl]methyl]benzene-1,2-diol (PubChem CID 70637767) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-[[4-[2-(diethylamino)ethyl]-2-phenylpiperazin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 4-[[4-[2-(diethylamino)ethyl]-2-phenylpiperazin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70637767 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 4-[[4-[2-(diethylamino)ethyl]-2-phenylpiperazin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCN(CC)CCN1CCN(Cc2ccc(O)c(O)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H33N3O2/c1-3-24(4-2)12-13-25-14-15-26(17-19-10-11-22(27)23(28)16-19)21(18-25)20-8-6-5-7-9-20/h5-11,16,21,27-28H,3-4,12-15,17-18H2,1-2H3 |
| InChIKey | RKLQPYARDTYXRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|