C15H24N6O6 — CID 70637836
ethyl 2-[[4,6-bis[(2-ethoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 70637836) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl 2-[[4,6-bis[(2-ethoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[4,6-bis[(2-ethoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 70637836 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl 2-[[4,6-bis[(2-ethoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(NCC(=O)OCC)nc(NCC(=O)OCC)n1 |
| InChI | InChI=1S/C15H24N6O6/c1-4-25-10(22)7-16-13-19-14(17-8-11(23)26-5-2)21-15(20-13)18-9-12(24)27-6-3/h4-9H2,1-3H3,(H3,16,17,18,19,20,21) |
| InChIKey | WNIXUFJVOHHFEO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|