About [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate
[(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate (PubChem CID 70638098) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate |
| PubChem CID | 70638098 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)C=CC(C(=O)C(C)(C)C)=CC1 |
| InChI | InChI=1S/C14H20O3/c1-10(15)17-14(5)8-6-11(7-9-14)12(16)13(2,3)4/h6-8H,9H2,1-5H3/t14-/m1/s1 |
| InChIKey | ANJJSAARPMGFPQ-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate (CID 70638098) is [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate is CC(=O)O[C@]1(C)C=CC(C(=O)C(C)(C)C)=CC1.
What is the InChIKey of [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is ANJJSAARPMGFPQ-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20O3/c1-10(15)17-14(5)8-6-11(7-9-14)12(16)13(2,3)4/h6-8H,9H2,1-5H3/t14-/m1/s1.
What are the key properties of [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate?
[(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 236.31 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-4-(2,2-dimethylpropanoyl)-1-methylcyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 70638098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).