About 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane
2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane (PubChem CID 70638284) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane |
| PubChem CID | 70638284 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane |
| SMILES | COC(C)(C)CCC/C(C)=C/CCC1(C)OCCO1 |
| InChI | InChI=1S/C16H30O3/c1-14(8-6-10-15(2,3)17-5)9-7-11-16(4)18-12-13-19-16/h9H,6-8,10-13H2,1-5H3/b14-9+ |
| InChIKey | OOIHSLXLXWTTKE-NTEUORMPSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane?
The IUPAC name of 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane (CID 70638284) is 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane.
What is the SMILES notation for 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane?
The canonical SMILES for 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane is COC(C)(C)CCC/C(C)=C/CCC1(C)OCCO1.
What is the InChIKey of 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane?
The InChIKey is OOIHSLXLXWTTKE-NTEUORMPSA-N. The full InChI is InChI=1S/C16H30O3/c1-14(8-6-10-15(2,3)17-5)9-7-11-16(4)18-12-13-19-16/h9H,6-8,10-13H2,1-5H3/b14-9+.
What are the key properties of 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane?
2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane has a molecular weight of 270.41 g/mol, XLogP of 4.07, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-8-methoxy-4,8-dimethylnon-3-enyl]-2-methyl-1,3-dioxolane is sourced from PubChem (CID 70638284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).