C16H31NO2 — CID 70638396
2,4,4,8,8,9,10,10-octamethyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 70638396) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2,4,4,8,8,9,10,10-octamethyl-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 2,4,4,8,8,9,10,10-octamethyl-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 70638396 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2,4,4,8,8,9,10,10-octamethyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CC1CC(C)(C)OC2(CC(C)(C)N(C)C(C)(C)C2)O1 |
| InChI | InChI=1S/C16H31NO2/c1-12-9-15(6,7)19-16(18-12)10-13(2,3)17(8)14(4,5)11-16/h12H,9-11H2,1-8H3 |
| InChIKey | OFUWTAWAOHHZHU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |