About 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate (PubChem CID 7063870) has the molecular formula C8H9N2O3-
and a molecular weight of 181.17 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate |
| PubChem CID | 7063870 |
| Molecular Formula | C8H9N2O3- |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)[O-] |
| InChI | InChI=1S/C8H10N2O3/c1-4-6(3-7(11)12)5(2)10-8(13)9-4/h3H2,1-2H3,(H,11,12)(H,9,10,13)/p-1 |
| InChIKey | BZHPNUFOKOBIBV-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate?
The IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate (CID 7063870) is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate?
The canonical SMILES for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate is Cc1nc(=O)[nH]c(C)c1CC(=O)[O-].
What is the InChIKey of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate?
The InChIKey is BZHPNUFOKOBIBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N2O3/c1-4-6(3-7(11)12)5(2)10-8(13)9-4/h3H2,1-2H3,(H,11,12)(H,9,10,13)/p-1.
What are the key properties of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate?
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate has a molecular weight of 181.17 g/mol, XLogP of -1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetate is sourced from PubChem (CID 7063870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).