About 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran
6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 70638851) has the molecular formula C22H34O3
and a molecular weight of 346.51 g/mol. Its IUPAC name is 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran.
Molecular Properties
| Compound Name | 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran |
| PubChem CID | 70638851 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CCC(C)(CCC/C(C)=C/COc1ccc2c(c1)OCC2(C)C)OC |
| InChI | InChI=1S/C22H34O3/c1-7-22(5,23-6)13-8-9-17(2)12-14-24-18-10-11-19-20(15-18)25-16-21(19,3)4/h10-12,15H,7-9,13-14,16H2,1-6H3/b17-12+ |
| InChIKey | LEQWOVIAJLETQL-SFQUDFHCSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran?
The IUPAC name of 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran (CID 70638851) is 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran.
What is the SMILES notation for 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran?
The canonical SMILES for 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran is CCC(C)(CCC/C(C)=C/COc1ccc2c(c1)OCC2(C)C)OC.
What is the InChIKey of 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran?
The InChIKey is LEQWOVIAJLETQL-SFQUDFHCSA-N. The full InChI is InChI=1S/C22H34O3/c1-7-22(5,23-6)13-8-9-17(2)12-14-24-18-10-11-19-20(15-18)25-16-21(19,3)4/h10-12,15H,7-9,13-14,16H2,1-6H3/b17-12+.
What are the key properties of 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran?
6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran has a molecular weight of 346.51 g/mol, XLogP of 5.67, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-7-methoxy-3,7-dimethylnon-2-enoxy]-3,3-dimethyl-2H-1-benzofuran is sourced from PubChem (CID 70638851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).