C16H27N5O3S — CID 70638943
3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-1-methyl-4-morpholin-4-ylimidazolidin-2-one (PubChem CID 70638943) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-1-methyl-4-morpholin-4-ylimidazolidin-2-one.
| Compound Name | 3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-1-methyl-4-morpholin-4-ylimidazolidin-2-one |
|---|---|
| PubChem CID | 70638943 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-(5-hexoxy-1,3,4-thiadiazol-2-yl)-1-methyl-4-morpholin-4-ylimidazolidin-2-one |
| SMILES | CCCCCCOc1nnc(N2C(=O)N(C)CC2N2CCOCC2)s1 |
| InChI | InChI=1S/C16H27N5O3S/c1-3-4-5-6-9-24-15-18-17-14(25-15)21-13(12-19(2)16(21)22)20-7-10-23-11-8-20/h13H,3-12H2,1-2H3 |
| InChIKey | ZFAVJLDRDPAVJP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|