C16H22O2 — CID 70639080
7-but-2-enyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol (PubChem CID 70639080) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 7-but-2-enyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 7-but-2-enyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 70639080 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 7-but-2-enyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CC=CCc1cc2c(cc1O)C(C)CC(C)(C)O2 |
| InChI | InChI=1S/C16H22O2/c1-5-6-7-12-8-15-13(9-14(12)17)11(2)10-16(3,4)18-15/h5-6,8-9,11,17H,7,10H2,1-4H3 |
| InChIKey | HROUKSOEJISEFC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|