About 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine
2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine (PubChem CID 70639197) has the molecular formula C17H18FNO
and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine |
| PubChem CID | 70639197 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine |
| SMILES | CN(C)C1(C)C=c2cc(-c3ccc(F)cc3)oc2=CC1 |
| InChI | InChI=1S/C17H18FNO/c1-17(19(2)3)9-8-15-13(11-17)10-16(20-15)12-4-6-14(18)7-5-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | VVMXCETYCHXAQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine?
The IUPAC name of 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine (CID 70639197) is 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine.
What is the SMILES notation for 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine?
The canonical SMILES for 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine is CN(C)C1(C)C=c2cc(-c3ccc(F)cc3)oc2=CC1.
What is the InChIKey of 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine?
The InChIKey is VVMXCETYCHXAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO/c1-17(19(2)3)9-8-15-13(11-17)10-16(20-15)12-4-6-14(18)7-5-12/h4-8,10-11H,9H2,1-3H3.
What are the key properties of 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine?
2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine has a molecular weight of 271.33 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-N,N,5-trimethyl-6H-1-benzofuran-5-amine is sourced from PubChem (CID 70639197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).