C40H51N7O8 — CID 70639404
[3-[(dihydroxyamino)oxymethyl]phenyl] 2-[[2-[[2-(azepane-1-carbonylamino)-4-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoate (PubChem CID 70639404) has the molecular formula C40H51N7O8 and a molecular weight of 757.89 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl] 2-[[2-[[2-(azepane-1-carbonylamino)-4-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl] 2-[[2-[[2-(azepane-1-carbonylamino)-4-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 70639404 |
| Molecular Formula | C40H51N7O8 |
| Molecular Weight | 757.89 g/mol |
| Exact Mass | 757.38 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl] 2-[[2-[[2-(azepane-1-carbonylamino)-4-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoate |
| SMILES | CC(C)CC(NC(=O)N1CCCCCC1)C(=O)NC(Cc1cn(C)c2ccccc12)C(=O)NC(Cc1ccccn1)C(=O)Oc1cccc(CON(O)O)c1 |
| InChI | InChI=1S/C40H51N7O8/c1-27(2)21-33(44-40(51)46-19-10-4-5-11-20-46)37(48)42-34(23-29-25-45(3)36-17-7-6-16-32(29)36)38(49)43-35(24-30-14-8-9-18-41-30)39(50)55-31-15-12-13-28(22-31)26-54-47(52)53/h6-9,12-18,22,25,27,33-35,52-53H,4-5,10-11,19-21,23-24,26H2,1-3H3,(H,42,48)(H,43,49)(H,44,51) |
| InChIKey | GWDFPWDJKANTQH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 187.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|