C9H12O4 — CID 706398
(3R,8S)-3,8-dimethyl-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 706398) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3R,8S)-3,8-dimethyl-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | (3R,8S)-3,8-dimethyl-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 706398 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3R,8S)-3,8-dimethyl-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | C[C@@H]1CC2(C[C@H](C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C9H12O4/c1-5-3-9(7(10)12-5)4-6(2)13-8(9)11/h5-6H,3-4H2,1-2H3/t5-,6+,9? |
| InChIKey | QAMHNBFRAXJYEI-SFJPZXRQSA-N |
| XLogP | 0.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|