About 6-amino-7-nitro-4H-1,4-benzoxazin-3-one
6-amino-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 7064004) has the molecular formula C8H7N3O4
and a molecular weight of 209.16 g/mol. Its IUPAC name is 6-amino-7-nitro-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-amino-7-nitro-4H-1,4-benzoxazin-3-one |
| PubChem CID | 7064004 |
| Molecular Formula | C8H7N3O4 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 6-amino-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2 |
| InChI | InChI=1S/C8H7N3O4/c9-4-1-5-7(2-6(4)11(13)14)15-3-8(12)10-5/h1-2H,3,9H2,(H,10,12) |
| InChIKey | UKMPWBSPQZCXLA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-7-nitro-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7-nitro-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-amino-7-nitro-4H-1,4-benzoxazin-3-one (CID 7064004) is 6-amino-7-nitro-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-amino-7-nitro-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-amino-7-nitro-4H-1,4-benzoxazin-3-one is Nc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2.
What is the InChIKey of 6-amino-7-nitro-4H-1,4-benzoxazin-3-one?
The InChIKey is UKMPWBSPQZCXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O4/c9-4-1-5-7(2-6(4)11(13)14)15-3-8(12)10-5/h1-2H,3,9H2,(H,10,12).
What are the key properties of 6-amino-7-nitro-4H-1,4-benzoxazin-3-one?
6-amino-7-nitro-4H-1,4-benzoxazin-3-one has a molecular weight of 209.16 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7-nitro-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 7064004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).