C15H22O — CID 70640125
6-methoxy-1,2,3,4,4a,4b,5,9,10,10a-decahydrophenanthrene (PubChem CID 70640125) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4,4a,4b,5,9,10,10a-decahydrophenanthrene.
| Compound Name | 6-methoxy-1,2,3,4,4a,4b,5,9,10,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 70640125 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 6-methoxy-1,2,3,4,4a,4b,5,9,10,10a-decahydrophenanthrene |
| SMILES | COC1=CC=C2CCC3CCCCC3C2C1 |
| InChI | InChI=1S/C15H22O/c1-16-13-9-8-12-7-6-11-4-2-3-5-14(11)15(12)10-13/h8-9,11,14-15H,2-7,10H2,1H3 |
| InChIKey | NMJWIKCUVZMMRW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |