About [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium
[(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium (PubChem CID 70640172) has the molecular formula C8H14O2P+
and a molecular weight of 173.17 g/mol. Its IUPAC name is [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium.
Molecular Properties
| Compound Name | [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium |
| PubChem CID | 70640172 |
| Molecular Formula | C8H14O2P+ |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium |
| SMILES | C=C[C@@H]1C[C@]1(C)[P+](=O)OCC |
| InChI | InChI=1S/C8H14O2P/c1-4-7-6-8(7,3)11(9)10-5-2/h4,7H,1,5-6H2,2-3H3/q+1/t7-,8+/m1/s1 |
| InChIKey | XTMNZZCVZAVNCG-SFYZADRCSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium?
The IUPAC name of [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium (CID 70640172) is [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium.
What is the SMILES notation for [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium?
The canonical SMILES for [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium is C=C[C@@H]1C[C@]1(C)[P+](=O)OCC.
What is the InChIKey of [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium?
The InChIKey is XTMNZZCVZAVNCG-SFYZADRCSA-N. The full InChI is InChI=1S/C8H14O2P/c1-4-7-6-8(7,3)11(9)10-5-2/h4,7H,1,5-6H2,2-3H3/q+1/t7-,8+/m1/s1.
What are the key properties of [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium?
[(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium has a molecular weight of 173.17 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxy-oxophosphanium is sourced from PubChem (CID 70640172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).