About 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole
5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole (PubChem CID 70640497) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole |
| PubChem CID | 70640497 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole |
| SMILES | Cc1cc2c([nH]1)=NCC=2 |
| InChI | InChI=1S/C7H8N2/c1-5-4-6-2-3-8-7(6)9-5/h2,4H,3H2,1H3,(H,8,9) |
| InChIKey | CHPXVXQZLWEFKN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole?
The IUPAC name of 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole (CID 70640497) is 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole.
What is the SMILES notation for 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole?
The canonical SMILES for 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole is Cc1cc2c([nH]1)=NCC=2.
What is the InChIKey of 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole?
The InChIKey is CHPXVXQZLWEFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-5-4-6-2-3-8-7(6)9-5/h2,4H,3H2,1H3,(H,8,9).
What are the key properties of 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole?
5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole has a molecular weight of 120.15 g/mol, XLogP of -0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,6-dihydropyrrolo[2,3-b]pyrrole is sourced from PubChem (CID 70640497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).