About 3,5-dimethoxy-1-methylcyclohexa-1,3-diene
3,5-dimethoxy-1-methylcyclohexa-1,3-diene (PubChem CID 70640540) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3,5-dimethoxy-1-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3,5-dimethoxy-1-methylcyclohexa-1,3-diene |
| PubChem CID | 70640540 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3,5-dimethoxy-1-methylcyclohexa-1,3-diene |
| SMILES | COC1=CC(OC)CC(C)=C1 |
| InChI | InChI=1S/C9H14O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4,6,9H,5H2,1-3H3 |
| InChIKey | TXFQTYMXDMMDMT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethoxy-1-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The IUPAC name of 3,5-dimethoxy-1-methylcyclohexa-1,3-diene (CID 70640540) is 3,5-dimethoxy-1-methylcyclohexa-1,3-diene.
What is the SMILES notation for 3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The canonical SMILES for 3,5-dimethoxy-1-methylcyclohexa-1,3-diene is COC1=CC(OC)CC(C)=C1.
What is the InChIKey of 3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The InChIKey is TXFQTYMXDMMDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4,6,9H,5H2,1-3H3.
What are the key properties of 3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
3,5-dimethoxy-1-methylcyclohexa-1,3-diene has a molecular weight of 154.21 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxy-1-methylcyclohexa-1,3-diene is sourced from PubChem (CID 70640540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).