C12H18N2O2S — CID 7064087
N,N-diethyl-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 7064087) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is N,N-diethyl-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | N,N-diethyl-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 7064087 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N,N-diethyl-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C12H18N2O2S/c1-3-14(4-2)17(15,16)11-5-6-12-10(9-11)7-8-13-12/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | LDAUEKPMNUEUGU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |