About 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine
6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 7064118) has the molecular formula C9H8F3NS
and a molecular weight of 219.23 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 7064118 |
| Molecular Formula | C9H8F3NS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)NCCS2 |
| InChI | InChI=1S/C9H8F3NS/c10-9(11,12)6-1-2-8-7(5-6)13-3-4-14-8/h1-2,5,13H,3-4H2 |
| InChIKey | MEJJCPDHJCPHMO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine (CID 7064118) is 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine is FC(F)(F)c1ccc2c(c1)NCCS2.
What is the InChIKey of 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is MEJJCPDHJCPHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NS/c10-9(11,12)6-1-2-8-7(5-6)13-3-4-14-8/h1-2,5,13H,3-4H2.
What are the key properties of 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 219.23 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 7064118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).