About 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide
4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 70642283) has the molecular formula C11H10N6O
and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide |
| PubChem CID | 70642283 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc2[nH]ccc2c1)c1nonc1N |
| InChI | InChI=1S/C11H10N6O/c12-10(9-11(13)17-18-16-9)15-7-1-2-8-6(5-7)3-4-14-8/h1-5,14H,(H2,12,15)(H2,13,17) |
| InChIKey | XQDOOFKZTATQHX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide?
The IUPAC name of 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide (CID 70642283) is 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide.
What is the SMILES notation for 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide?
The canonical SMILES for 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide is N/C(=N\c1ccc2[nH]ccc2c1)c1nonc1N.
What is the InChIKey of 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide?
The InChIKey is XQDOOFKZTATQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6O/c12-10(9-11(13)17-18-16-9)15-7-1-2-8-6(5-7)3-4-14-8/h1-5,14H,(H2,12,15)(H2,13,17).
What are the key properties of 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide?
4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide has a molecular weight of 242.24 g/mol, XLogP of 1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N'-(1H-indol-5-yl)-1,2,5-oxadiazole-3-carboximidamide is sourced from PubChem (CID 70642283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).