About N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide
N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide (PubChem CID 70642311) has the molecular formula C22H15BrFN5O2
and a molecular weight of 480.30 g/mol. Its IUPAC name is N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide |
| PubChem CID | 70642311 |
| Molecular Formula | C22H15BrFN5O2 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide |
| SMILES | N/C(=N\c1ccc(F)c(Br)c1)c1nonc1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15BrFN5O2/c23-17-12-16(10-11-18(17)24)26-20(25)19-21(29-31-28-19)27-22(30)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H2,25,26)(H,27,29,30) |
| InChIKey | FIWHYADEBOIFHK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide?
The IUPAC name of N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide (CID 70642311) is N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide.
What is the SMILES notation for N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide?
The canonical SMILES for N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide is N/C(=N\c1ccc(F)c(Br)c1)c1nonc1NC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide?
The InChIKey is FIWHYADEBOIFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrFN5O2/c23-17-12-16(10-11-18(17)24)26-20(25)19-21(29-31-28-19)27-22(30)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H2,25,26)(H,27,29,30).
What are the key properties of N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide?
N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide has a molecular weight of 480.30 g/mol, XLogP of 4.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[N'-(3-bromo-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]-4-phenylbenzamide is sourced from PubChem (CID 70642311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).