C16H28O3 — CID 70642750
(2S)-1-[(4R,5R)-5-(cyclohexylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol (PubChem CID 70642750) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S)-1-[(4R,5R)-5-(cyclohexylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol.
| Compound Name | (2S)-1-[(4R,5R)-5-(cyclohexylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 70642750 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2S)-1-[(4R,5R)-5-(cyclohexylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol |
| SMILES | C=C[C@@H](O)C[C@H]1OC(C)(C)O[C@@H]1CC1CCCCC1 |
| InChI | InChI=1S/C16H28O3/c1-4-13(17)11-15-14(18-16(2,3)19-15)10-12-8-6-5-7-9-12/h4,12-15,17H,1,5-11H2,2-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | XNJBOTAYCXNXPQ-RBSFLKMASA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|