C19H32O3 — CID 70642772
(4R,5R)-4-heptyl-5-[(4R)-4-methoxyhex-5-en-2-ynyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 70642772) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-5-[(4R)-4-methoxyhex-5-en-2-ynyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-5-[(4R)-4-methoxyhex-5-en-2-ynyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 70642772 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (4R,5R)-4-heptyl-5-[(4R)-4-methoxyhex-5-en-2-ynyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C[C@H](C#CC[C@H]1OC(C)(C)O[C@@H]1CCCCCCC)OC |
| InChI | InChI=1S/C19H32O3/c1-6-8-9-10-11-14-17-18(22-19(3,4)21-17)15-12-13-16(7-2)20-5/h7,16-18H,2,6,8-11,14-15H2,1,3-5H3/t16-,17-,18-/m1/s1 |
| InChIKey | HYSHQNXGTYSAFK-KZNAEPCWSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|