C17H32O3 — CID 70643244
(4R,5R)-4-heptyl-5-[(2S)-2-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 70643244) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-5-[(2S)-2-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-5-[(2S)-2-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 70643244 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (4R,5R)-4-heptyl-5-[(2S)-2-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C[C@H](C[C@H]1OC(C)(C)O[C@@H]1CCCCCCC)OC |
| InChI | InChI=1S/C17H32O3/c1-6-8-9-10-11-12-15-16(13-14(7-2)18-5)20-17(3,4)19-15/h7,14-16H,2,6,8-13H2,1,3-5H3/t14-,15-,16-/m1/s1 |
| InChIKey | BKPBPHRWZXIYME-BZUAXINKSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|