C18H32O4 — CID 70643274
[(2S)-1-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl] acetate (PubChem CID 70643274) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is [(2S)-1-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl] acetate.
| Compound Name | [(2S)-1-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 70643274 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [(2S)-1-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl] acetate |
| SMILES | C=C[C@H](C[C@H]1OC(C)(C)O[C@@H]1CCCCCCC)OC(C)=O |
| InChI | InChI=1S/C18H32O4/c1-6-8-9-10-11-12-16-17(22-18(4,5)21-16)13-15(7-2)20-14(3)19/h7,15-17H,2,6,8-13H2,1,3-5H3/t15-,16-,17-/m1/s1 |
| InChIKey | UJLFWBODPBFNSB-BRWVUGGUSA-N |
| XLogP | 4.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|