C29H50O6Si — CID 70643536
2-[(1S,2S)-2-[(4R,7aS)-4-acetyloxy-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]ethyl acetate (PubChem CID 70643536) has the molecular formula C29H50O6Si and a molecular weight of 522.80 g/mol. Its IUPAC name is 2-[(1S,2S)-2-[(4R,7aS)-4-acetyloxy-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]ethyl acetate.
| Compound Name | 2-[(1S,2S)-2-[(4R,7aS)-4-acetyloxy-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]ethyl acetate |
|---|---|
| PubChem CID | 70643536 |
| Molecular Formula | C29H50O6Si |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | 2-[(1S,2S)-2-[(4R,7aS)-4-acetyloxy-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1CC(O[Si](C)(C)C(C)(C)C)CC[C@]1(C)C1CC[C@]2(C)C(=O)CCC2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H50O6Si/c1-19(30)33-17-14-21-18-22(35-36(8,9)27(3,4)5)12-15-28(21,6)24-13-16-29(7)23(10-11-25(29)32)26(24)34-20(2)31/h21-24,26H,10-18H2,1-9H3/t21-,22?,23?,24?,26-,28-,29-/m0/s1 |
| InChIKey | SSBIHCCYRATBBI-IQOWFFPPSA-N |
| XLogP | 6.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|