C31H60O3Si2 — CID 70643550
(4R,7aR)-5-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 70643550) has the molecular formula C31H60O3Si2 and a molecular weight of 536.99 g/mol. Its IUPAC name is (4R,7aR)-5-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (4R,7aR)-5-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 70643550 |
| Molecular Formula | C31H60O3Si2 |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | (4R,7aR)-5-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-methylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]1(C)C1CC[C@]2(C)C=CCC2[C@@H]1O |
| InChI | InChI=1S/C31H60O3Si2/c1-28(2,3)35(9,10)33-21-17-23-22-24(34-36(11,12)29(4,5)6)15-20-31(23,8)26-16-19-30(7)18-13-14-25(30)27(26)32/h13,18,23-27,32H,14-17,19-22H2,1-12H3/t23-,24-,25?,26?,27-,30-,31-/m0/s1 |
| InChIKey | LMMIJSGZTUVHNN-DFYIZTMXSA-N |
| XLogP | 8.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|