About methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate
methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate (PubChem CID 70643586) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate.
Molecular Properties
| Compound Name | methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate |
| PubChem CID | 70643586 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate |
| SMILES | C=CC(NC1OC(c2ccccc2)O1)C(=O)OC |
| InChI | InChI=1S/C13H15NO4/c1-3-10(11(15)16-2)14-13-17-12(18-13)9-7-5-4-6-8-9/h3-8,10,12-14H,1H2,2H3 |
| InChIKey | HDWYDIVCXQSAMD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate?
The IUPAC name of methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate (CID 70643586) is methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate.
What is the SMILES notation for methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate?
The canonical SMILES for methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate is C=CC(NC1OC(c2ccccc2)O1)C(=O)OC.
What is the InChIKey of methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate?
The InChIKey is HDWYDIVCXQSAMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-3-10(11(15)16-2)14-13-17-12(18-13)9-7-5-4-6-8-9/h3-8,10,12-14H,1H2,2H3.
What are the key properties of methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate?
methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate has a molecular weight of 249.27 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-phenyl-1,3-dioxetan-2-yl)amino]but-3-enoate is sourced from PubChem (CID 70643586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).