C22H26F3N5O2S — CID 70643910
cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxypropyl)cyclopentan-1-ol (PubChem CID 70643910) has the molecular formula C22H26F3N5O2S and a molecular weight of 481.54 g/mol. Its IUPAC name is cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxypropyl)cyclopentan-1-ol.
| Compound Name | cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxypropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70643910 |
| Molecular Formula | C22H26F3N5O2S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxypropyl)cyclopentan-1-ol |
| SMILES | CCC(O)C1C[C@@H](Nc2nc(NCC(F)(F)F)nc(C)c2-c2nc3ccccc3s2)C[C@@H]1O |
| InChI | InChI=1S/C22H26F3N5O2S/c1-3-15(31)13-8-12(9-16(13)32)28-19-18(20-29-14-6-4-5-7-17(14)33-20)11(2)27-21(30-19)26-10-22(23,24)25/h4-7,12-13,15-16,31-32H,3,8-10H2,1-2H3,(H2,26,27,28,30)/t12-,13?,15?,16+/m1/s1 |
| InChIKey | VYNZTKIIKWAPQD-XCAIRMDXSA-N |
| XLogP | 4.36 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |