C27H31N5OS — CID 70643968
[(1S,2S,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-(dimethylamino)-6-phenylpyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol (PubChem CID 70643968) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-(dimethylamino)-6-phenylpyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol.
| Compound Name | [(1S,2S,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-(dimethylamino)-6-phenylpyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 70643968 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [(1S,2S,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-(dimethylamino)-6-phenylpyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)C[C@@H](Nc2nc(N(C)C)nc(-c3ccccc3)c2-c2nc3ccccc3s2)[C@@H]1C |
| InChI | InChI=1S/C27H31N5OS/c1-16-17(2)21(14-19(16)15-33)28-25-23(26-29-20-12-8-9-13-22(20)34-26)24(18-10-6-5-7-11-18)30-27(31-25)32(3)4/h5-13,16-17,19,21,33H,14-15H2,1-4H3,(H,28,30,31)/t16-,17+,19+,21+/m0/s1 |
| InChIKey | VCNJWQDCOQPCKV-GMLUQMLDSA-N |
| XLogP | 5.55 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |