C19H21F3N6OS — CID 70644103
[(1R,3S)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 70644103) has the molecular formula C19H21F3N6OS and a molecular weight of 438.48 g/mol. Its IUPAC name is [(1R,3S)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 70644103 |
| Molecular Formula | C19H21F3N6OS |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(1R,3S)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@H]2CC[C@@H](CO)C2)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C19H21F3N6OS/c1-10-15(17-27-13-7-23-5-4-14(13)30-17)16(26-12-3-2-11(6-12)8-29)28-18(25-10)24-9-19(20,21)22/h4-5,7,11-12,29H,2-3,6,8-9H2,1H3,(H2,24,25,26,28)/t11-,12+/m1/s1 |
| InChIKey | WTOFYGLYUMPBBN-NEPJUHHUSA-N |
| XLogP | 4.00 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |