C27H33F3N4O4 — CID 70644760
1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one (PubChem CID 70644760) has the molecular formula C27H33F3N4O4 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70644760 |
| Molecular Formula | C27H33F3N4O4 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one |
| SMILES | COc1cc(NC2CCN(C(=O)CCN3CCC(c4ccc(C(F)(F)F)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H33F3N4O4/c1-38-25-18-23(6-7-24(25)34(36)37)31-22-10-16-33(17-11-22)26(35)12-15-32-13-8-20(9-14-32)19-2-4-21(5-3-19)27(28,29)30/h2-7,18,20,22,31H,8-17H2,1H3 |
| InChIKey | WUXPRHRPPSEFQL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|