C17H24N2O — CID 70645004
(6Z,9E)-5-amino-6-ethylidene-5,9,11-trimethyl-1,7,8,11-tetrahydrocyclonona[b]pyridin-2-one (PubChem CID 70645004) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (6Z,9E)-5-amino-6-ethylidene-5,9,11-trimethyl-1,7,8,11-tetrahydrocyclonona[b]pyridin-2-one.
| Compound Name | (6Z,9E)-5-amino-6-ethylidene-5,9,11-trimethyl-1,7,8,11-tetrahydrocyclonona[b]pyridin-2-one |
|---|---|
| PubChem CID | 70645004 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (6Z,9E)-5-amino-6-ethylidene-5,9,11-trimethyl-1,7,8,11-tetrahydrocyclonona[b]pyridin-2-one |
| SMILES | C/C=C1/CC/C(C)=C/C(C)c2[nH]c(=O)ccc2C1(C)N |
| InChI | InChI=1S/C17H24N2O/c1-5-13-7-6-11(2)10-12(3)16-14(17(13,4)18)8-9-15(20)19-16/h5,8-10,12H,6-7,18H2,1-4H3,(H,19,20)/b11-10+,13-5- |
| InChIKey | ZWSQUNJBYZZZMK-OGNCIKNXSA-N |
| XLogP | 3.34 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|