C13H20N2O6 — CID 70645249
N-[1-(2,3-dihydroxypropoxy)propyl]-2-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 70645249) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-[1-(2,3-dihydroxypropoxy)propyl]-2-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[1-(2,3-dihydroxypropoxy)propyl]-2-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 70645249 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[1-(2,3-dihydroxypropoxy)propyl]-2-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CCC(NC(=O)C(C)N1C(=O)C=CC1=O)OCC(O)CO |
| InChI | InChI=1S/C13H20N2O6/c1-3-10(21-7-9(17)6-16)14-13(20)8(2)15-11(18)4-5-12(15)19/h4-5,8-10,16-17H,3,6-7H2,1-2H3,(H,14,20) |
| InChIKey | DUDCJMLDFISYTN-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|