C18H14N2 — CID 70645311
3-[methyl(naphthalen-1-yl)amino]benzonitrile (PubChem CID 70645311) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[methyl(naphthalen-1-yl)amino]benzonitrile.
| Compound Name | 3-[methyl(naphthalen-1-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 70645311 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-[methyl(naphthalen-1-yl)amino]benzonitrile |
| SMILES | CN(c1cccc(C#N)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H14N2/c1-20(16-9-4-6-14(12-16)13-19)18-11-5-8-15-7-2-3-10-17(15)18/h2-12H,1H3 |
| InChIKey | RWRSZEZHIUQHQV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |