About N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline
N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline (PubChem CID 70645342) has the molecular formula C28H28N2O
and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline |
| PubChem CID | 70645342 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline |
| SMILES | COc1ccccc1C(Nc1c(C)cc(C)cc1C)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H28N2O/c1-19-17-20(2)27(21(3)18-19)30-28(23-13-8-9-16-26(23)31-4)25-15-10-14-24(29-25)22-11-6-5-7-12-22/h5-18,28,30H,1-4H3 |
| InChIKey | DZCYKWAYXRFARG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline?
The IUPAC name of N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline (CID 70645342) is N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline.
What is the SMILES notation for N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline?
The canonical SMILES for N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline is COc1ccccc1C(Nc1c(C)cc(C)cc1C)c1cccc(-c2ccccc2)n1.
What is the InChIKey of N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline?
The InChIKey is DZCYKWAYXRFARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O/c1-19-17-20(2)27(21(3)18-19)30-28(23-13-8-9-16-26(23)31-4)25-15-10-14-24(29-25)22-11-6-5-7-12-22/h5-18,28,30H,1-4H3.
What are the key properties of N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline?
N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline has a molecular weight of 408.55 g/mol, XLogP of 6.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methoxyphenyl)-(6-phenyl-2-pyridinyl)methyl]-2,4,6-trimethylaniline is sourced from PubChem (CID 70645342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).