About 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile
5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile (PubChem CID 70645411) has the molecular formula C13H8N6
and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile |
| PubChem CID | 70645411 |
| Molecular Formula | C13H8N6 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile |
| SMILES | CN1c2ccccc2Nc2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C13H8N6/c1-19-11-5-3-2-4-8(11)16-12-13(19)18-10(7-15)9(6-14)17-12/h2-5H,1H3,(H,16,17) |
| InChIKey | JWQMKDMHYZRVOK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile?
The IUPAC name of 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile (CID 70645411) is 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile.
What is the SMILES notation for 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile?
The canonical SMILES for 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile is CN1c2ccccc2Nc2nc(C#N)c(C#N)nc21.
What is the InChIKey of 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile?
The InChIKey is JWQMKDMHYZRVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N6/c1-19-11-5-3-2-4-8(11)16-12-13(19)18-10(7-15)9(6-14)17-12/h2-5H,1H3,(H,16,17).
What are the key properties of 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile?
5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile has a molecular weight of 248.25 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-10H-pyrazino[2,3-b]quinoxaline-2,3-dicarbonitrile is sourced from PubChem (CID 70645411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).