About 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one
1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one (PubChem CID 70645703) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one.
Molecular Properties
| Compound Name | 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one |
| PubChem CID | 70645703 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one |
| SMILES | CC1C(=O)N(O)C2=CC=CCC21 |
| InChI | InChI=1S/C9H11NO2/c1-6-7-4-2-3-5-8(7)10(12)9(6)11/h2-3,5-7,12H,4H2,1H3 |
| InChIKey | TVQAIXHRUWANAE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one?
The IUPAC name of 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one (CID 70645703) is 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one.
What is the SMILES notation for 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one?
The canonical SMILES for 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one is CC1C(=O)N(O)C2=CC=CCC21.
What is the InChIKey of 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one?
The InChIKey is TVQAIXHRUWANAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-7-4-2-3-5-8(7)10(12)9(6)11/h2-3,5-7,12H,4H2,1H3.
What are the key properties of 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one?
1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one has a molecular weight of 165.19 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3-methyl-3a,4-dihydro-3H-indol-2-one is sourced from PubChem (CID 70645703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).