C17H27N7O2 — CID 70646050
3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]propanamide (PubChem CID 70646050) has the molecular formula C17H27N7O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]propanamide.
| Compound Name | 3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]propanamide |
|---|---|
| PubChem CID | 70646050 |
| Molecular Formula | C17H27N7O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]propanamide |
| SMILES | CC(C)(C)c1cc2cn(CCC(=O)NCCCN=C(N)N)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C17H27N7O2/c1-17(2,3)12-9-11-10-24(16(26)23-14(11)22-12)8-5-13(25)20-6-4-7-21-15(18)19/h9-10H,4-8H2,1-3H3,(H,20,25)(H4,18,19,21)(H,22,23,26) |
| InChIKey | YYAZVVKUFVMOJF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|