About 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine
4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine (PubChem CID 70646238) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine |
| PubChem CID | 70646238 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine |
| SMILES | CC(c1cc(CCCCN)cc(C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C20H35N/c1-15(19(2,3)4)17-12-16(10-8-9-11-21)13-18(14-17)20(5,6)7/h12-15H,8-11,21H2,1-7H3 |
| InChIKey | SMCXKYISYAJXJL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine?
The IUPAC name of 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine (CID 70646238) is 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine.
What is the SMILES notation for 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine?
The canonical SMILES for 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine is CC(c1cc(CCCCN)cc(C(C)(C)C)c1)C(C)(C)C.
What is the InChIKey of 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine?
The InChIKey is SMCXKYISYAJXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-15(19(2,3)4)17-12-16(10-8-9-11-21)13-18(14-17)20(5,6)7/h12-15H,8-11,21H2,1-7H3.
What are the key properties of 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine?
4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine has a molecular weight of 289.51 g/mol, XLogP of 5.42, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-tert-butyl-5-(3,3-dimethylbutan-2-yl)phenyl]butan-1-amine is sourced from PubChem (CID 70646238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).