C27H27FN4 — CID 70646512
2-[2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]ethanamine (PubChem CID 70646512) has the molecular formula C27H27FN4 and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]ethanamine.
| Compound Name | 2-[2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]ethanamine |
|---|---|
| PubChem CID | 70646512 |
| Molecular Formula | C27H27FN4 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]ethanamine |
| SMILES | Cc1ccc2c(c1)CCc1cc(C)ccc1C2(CCN)c1nc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C27H27FN4/c1-17-3-11-23-20(15-17)5-6-21-16-18(2)4-12-24(21)27(23,13-14-29)26-30-25(31-32-26)19-7-9-22(28)10-8-19/h3-4,7-12,15-16H,5-6,13-14,29H2,1-2H3,(H,30,31,32) |
| InChIKey | HHDCRWZQZZSNIJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |