C29H33N7O3 — CID 70646788
2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 70646788) has the molecular formula C29H33N7O3 and a molecular weight of 527.63 g/mol. Its IUPAC name is 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 70646788 |
| Molecular Formula | C29H33N7O3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | C/N=C(\N)C1(CCNCC(=O)N2C(C#N)C[C@@H]3C[C@@H]32)c2ccc(C(N)=O)cc2CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C29H33N7O3/c1-34-28(33)29(8-9-35-15-25(37)36-21(14-30)12-20-13-24(20)36)22-6-4-18(26(31)38)10-16(22)2-3-17-11-19(27(32)39)5-7-23(17)29/h4-7,10-11,20-21,24,35H,2-3,8-9,12-13,15H2,1H3,(H2,31,38)(H2,32,39)(H2,33,34)/t20-,21?,24+/m1/s1 |
| InChIKey | QCSQHKBNFRTFEH-QQVDTZSYSA-N |
| XLogP | 0.75 |
| TPSA | 180.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|