C26H37N3O — CID 70647343
1-[2-[1-(2,7-dimethyl-1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)propan-2-ylamino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 70647343) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[2-[1-(2,7-dimethyl-1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)propan-2-ylamino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[2-[1-(2,7-dimethyl-1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)propan-2-ylamino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 70647343 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1-[2-[1-(2,7-dimethyl-1,2,3,4,5,6,7,8-octahydroanthracen-9-yl)propan-2-ylamino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | CC1CCc2cc3c(c(CC(C)NCC(=O)N4CCCC4C#N)c2C1)CC(C)CC3 |
| InChI | InChI=1S/C26H37N3O/c1-17-6-8-20-14-21-9-7-18(2)12-24(21)25(23(20)11-17)13-19(3)28-16-26(30)29-10-4-5-22(29)15-27/h14,17-19,22,28H,4-13,16H2,1-3H3 |
| InChIKey | CVJMBRQQAIJLHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |