About 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine
2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine (PubChem CID 70648151) has the molecular formula C12H22N2S2
and a molecular weight of 258.46 g/mol. Its IUPAC name is 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine.
Molecular Properties
| Compound Name | 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine |
| PubChem CID | 70648151 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine |
| SMILES | C=C1NC(CCSC)C(=C)NC1CCSC |
| InChI | InChI=1S/C12H22N2S2/c1-9-11(5-7-15-3)14-10(2)12(13-9)6-8-16-4/h11-14H,1-2,5-8H2,3-4H3 |
| InChIKey | HTYOZCQLGGKGEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine?
The IUPAC name of 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine (CID 70648151) is 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine.
What is the SMILES notation for 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine?
The canonical SMILES for 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine is C=C1NC(CCSC)C(=C)NC1CCSC.
What is the InChIKey of 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine?
The InChIKey is HTYOZCQLGGKGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S2/c1-9-11(5-7-15-3)14-10(2)12(13-9)6-8-16-4/h11-14H,1-2,5-8H2,3-4H3.
What are the key properties of 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine?
2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine has a molecular weight of 258.46 g/mol, XLogP of 2.45, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylidene-3,6-bis(2-methylsulfanylethyl)piperazine is sourced from PubChem (CID 70648151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).