2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid

C10H7FN2O3 — CID 70648615

IUPAC2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid
SMILESO=C(O)Cn1c(=O)ccc2ncc(F)cc21
InChIInChI=1S/C10H7FN2O3/c11-6-3-8-7(12-4-6)1-2-9(14)13(8)5-10(15)16/h1-4H,5H2,(H,15,16)
InChIKeySDUPAVWJXADMFV-UHFFFAOYSA-N
MW222.18 g/mol
LogP0.62
Rot. Bonds2

About 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid

2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid (PubChem CID 70648615) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid
PubChem CID70648615
Molecular FormulaC10H7FN2O3
Molecular Weight222.18 g/mol
Exact Mass222.04
IUPAC Name2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid
SMILESO=C(O)Cn1c(=O)ccc2ncc(F)cc21
InChIInChI=1S/C10H7FN2O3/c11-6-3-8-7(12-4-6)1-2-9(14)13(8)5-10(15)16/h1-4H,5H2,(H,15,16)
InChIKeySDUPAVWJXADMFV-UHFFFAOYSA-N
XLogP0.62
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.18
LogP ≤ 50.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid?
The IUPAC name of 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid (CID 70648615) is 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid?
The canonical SMILES for 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid is O=C(O)Cn1c(=O)ccc2ncc(F)cc21.
What is the InChIKey of 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid?
The InChIKey is SDUPAVWJXADMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O3/c11-6-3-8-7(12-4-6)1-2-9(14)13(8)5-10(15)16/h1-4H,5H2,(H,15,16).
What are the key properties of 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid?
2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid has a molecular weight of 222.18 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)acetic acid is sourced from PubChem (CID 70648615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).