C27H21FN4O2S — CID 70648822
3-(2,3-dihydro-1H-indol-5-yl)-5-(6-fluoro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 70648822) has the molecular formula C27H21FN4O2S and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-5-(6-fluoro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-5-(6-fluoro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70648822 |
| Molecular Formula | C27H21FN4O2S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-5-(6-fluoro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc4c(c3)CCN4)c3cc(-c4ccc(F)nc4)cnc32)cc1 |
| InChI | InChI=1S/C27H21FN4O2S/c1-17-2-6-22(7-3-17)35(33,34)32-16-24(18-4-8-25-19(12-18)10-11-29-25)23-13-21(15-31-27(23)32)20-5-9-26(28)30-14-20/h2-9,12-16,29H,10-11H2,1H3 |
| InChIKey | BOKSPEWILLQKEB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|