C13H21ClO2 — CID 706489
(1'S,2R,3'R,4S,4'S)-4-(chloromethyl)-2',2',3'-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane] (PubChem CID 706489) has the molecular formula C13H21ClO2 and a molecular weight of 244.76 g/mol. Its IUPAC name is (1'S,2R,3'R,4S,4'S)-4-(chloromethyl)-2',2',3'-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane].
| Compound Name | (1'S,2R,3'R,4S,4'S)-4-(chloromethyl)-2',2',3'-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 706489 |
| Molecular Formula | C13H21ClO2 |
| Molecular Weight | 244.76 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (1'S,2R,3'R,4S,4'S)-4-(chloromethyl)-2',2',3'-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane] |
| SMILES | C[C@@H]1[C@@H]2C[C@@H](C[C@]23OC[C@@H](CCl)O3)C1(C)C |
| InChI | InChI=1S/C13H21ClO2/c1-8-11-4-9(12(8,2)3)5-13(11)15-7-10(6-14)16-13/h8-11H,4-7H2,1-3H3/t8-,9+,10-,11+,13-/m1/s1 |
| InChIKey | ARRMJBMUKXIDRB-OOTJXSFTSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|