C24H35N5O3Si — CID 70649153
4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-one (PubChem CID 70649153) has the molecular formula C24H35N5O3Si and a molecular weight of 469.66 g/mol. Its IUPAC name is 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70649153 |
| Molecular Formula | C24H35N5O3Si |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-one |
| SMILES | C[Si](C)(C)CCOCn1ncn(C2C=CC(N3CCN(c4ccc(O)cc4)CC3)=CC2)c1=O |
| InChI | InChI=1S/C24H35N5O3Si/c1-33(2,3)17-16-32-19-29-24(31)28(18-25-29)22-6-4-20(5-7-22)26-12-14-27(15-13-26)21-8-10-23(30)11-9-21/h4-6,8-11,18,22,30H,7,12-17,19H2,1-3H3 |
| InChIKey | VGIZIBODPKLSRG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|