C13H25BN2O3 — CID 70649180
2-(1-ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole (PubChem CID 70649180) has the molecular formula C13H25BN2O3 and a molecular weight of 268.17 g/mol. Its IUPAC name is 2-(1-ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole.
| Compound Name | 2-(1-ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 70649180 |
| Molecular Formula | C13H25BN2O3 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-(1-ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole |
| SMILES | CCOC(C)N1C=C(B2OC(C)(C)C(C)(C)O2)CN1 |
| InChI | InChI=1S/C13H25BN2O3/c1-7-17-10(2)16-9-11(8-15-16)14-18-12(3,4)13(5,6)19-14/h9-10,15H,7-8H2,1-6H3 |
| InChIKey | KSHGIZDZOCOMHX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|