C18H19FN6O3 — CID 70649185
N-(2,2-dimethyloxan-4-yl)-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine (PubChem CID 70649185) has the molecular formula C18H19FN6O3 and a molecular weight of 386.39 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 70649185 |
| Molecular Formula | C18H19FN6O3 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1(C)CC(Nc2nc(-c3cnc4ccc(F)cn34)ncc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C18H19FN6O3/c1-18(2)7-12(5-6-28-18)22-17-14(25(26)27)9-21-16(23-17)13-8-20-15-4-3-11(19)10-24(13)15/h3-4,8-10,12H,5-7H2,1-2H3,(H,21,22,23) |
| InChIKey | YGZPKLXWCSIUQT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|